2,2,3-Trimethylpentane | C8H18 – PubChem.
What is the molecular formula C before h for 3 Methylpentane?
3-Methylpentane is a branched alkane with the molecular formula C6H14.
…
3-Methylpentane.
| Names | |
|---|---|
| Chemical formula | C6H14 |
| Molar mass | 86.178 g·mol−1 |
| Appearance | Colorless liquid |
| Odor | Odorless |
What is the molecular formula for 2 2 3-Trimethylbutane?
Help With Enantiomers : Example Question #2
2,3,4-trimethylpentane does not contain any stereocenters. … This compound, therefore, would have no stereocenters and could only exist as one stereoisomer.
What is the structural formula for 2 3 3 Trimethylhexane?
2,3,3-Trimethylhexane
| PubChem CID | 28023 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C9H20 |
| Synonyms | 2,3,3-TRIMETHYLHEXANE 16747-28-7 Hexane, 2,3,3-trimethyl- EINECS 240-808-2 2,3,3-Teimethylhexane More… |
| Molecular Weight | 128.25 |
What is the structural formula for 2 Methylpentane?
2,2,3-Trimethylbutane
| PubChem CID | 10044 |
|---|---|
| Synonyms | 2,2,3-TRIMETHYLBUTANE Triptan 464-06-2 Butane, 2,2,3-trimethyl- Triptane More… |
| Molecular Weight | 100.20 |
| Dates | Modify 2021-12-11 Create 2005-03-26 |
| Description | Decarboxylated monoamine derivatives of TRYPTOPHAN. Medical Subject Headings (MeSH) |
What is the structure of 2 bromo 3 Chlorobutane?
(2S,3R)-2-bromo-3-chlorobutane
| PubChem CID | 57480747 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C4H8BrCl |
| Synonyms | (2S,3R)-2-Brom-3-chlorbutan (2S,3R)-2-bromo-3-chlorobutane |
| Molecular Weight | 171.46 |
What is the Iupac name of isobutylene?
| IUPAC Name | 2-methylprop-1-ene |
|---|---|
| Alternative Names | Isobutene 2-Methylpropene 2-Methylpropylene |
| Molecular Formula | C4H8 |
| Molar Mass | 56.108 g/mol |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
Which compound is 2 2 3-Trimethylpentane?
2,2,3-Trimethylpentane
| PubChem CID | 11255 |
|---|---|
| Molecular Formula | C8H18 |
| Synonyms | 2,2,3-TRIMETHYLPENTANE 564-02-3 Pentane, 2,2,3-trimethyl- NSC73954 EINECS 209-266-4 More… |
| Molecular Weight | 114.23 |
| Dates | Modify 2021-12-11 Create 2005-03-26 |
What is the molecular formula for alkane 2 2 4-Trimethylpentane?
2,2,4-Trimethylpentane, also known as isooctane or iso-octane, is an organic compound with the formula (CH3)3CCH2CH(CH3)2. It is one of several isomers of octane (C8H18).
What is the correct condensed formula for 2 2 4-Trimethylpentane?
2,2,4-Trimethylpentane, also known as isooctane or iso-octane, is an organic compound with the formula (CH3)3CCH2CH(CH3)2. It is one of several isomers of octane (C8H18). This particular isomer is the standard 100 point on the octane rating scale (the zero point is n-heptane).
What is the structure of 3 ethyl 3 Methylpentane?
3-Ethyl-3-methylpentane
| PubChem CID | 14018 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H18 |
| Synonyms | 3-Ethyl-3-methylpentane 1067-08-9 Pentane, 3-ethyl-3-methyl- 3-METHYL-3-ETHYLPENTANE 2,2-diethylbutane More… |
| Molecular Weight | 114.23 |
What is the structural formula for 2 2 4 Trimethylhexane?
2,2,4-Trimethylhexane
| PubChem CID | 28022 |
|---|---|
| Molecular Formula | C9H20 |
| Synonyms | 2,2,4-TRIMETHYLHEXANE 16747-26-5 Hexane, 2,2,4-trimethyl- AI3-28854 EINECS 240-807-7 More… |
| Molecular Weight | 128.25 |
| Dates | Modify 2021-12-05 Create 2005-03-27 |
What is the structure of 223 Trimethylpentane?
2,3,3-Trimethylpentane is a chemical compound in the family of hydrocarbons which has a formula of C8H18. It is an isomer of octane.