What is the molecular formula C before h for 2 2 3 Trimethylbutane?

What is the molecular formula C before h for 2 2 3 Trimethylpentane?

(R)-2,2,3-Trimethylpentane

PubChem CID 57480759
Molecular Formula C8H18
Synonyms (R)-2,2,3-Trimethylpentane UNII-AKF4GAE23M AKF4GAE23M r-2,2,3-trimethyl pentane (+)-2,2,3-Trimethylpentane More…
Molecular Weight 114.23
Dates Modify 2021-11-13 Create 2012-08-08

What is the molecular formula for 2 2 3-Trimethylbutane?

2,2,3-Trimethylbutane | C7H16 – PubChem.

Which of the following is the octane number of 2 2 3 trimethyl butane accepted?

2,2,3-Trimethylbutane (i.e., triptane) is a potential gasoline octane booster with a research octane number (RON) of 112.

What is the molecular formula for alkane 2 2 4-Trimethylpentane?

2,2,4-Trimethylpentane, also known as isooctane or iso-octane, is an organic compound with the formula (CH3)3CCH2CH(CH3)2. It is one of several isomers of octane (C8H18).

What is the structure of 223 Trimethylpentane?

2,3,3-Trimethylpentane is a chemical compound in the family of hydrocarbons which has a formula of C8H18. It is an isomer of octane.

What is the structure of 2 bromo 3 Chlorobutane?

(2S,3R)-2-bromo-3-chlorobutane

PubChem CID 57480747
Structure Find Similar Structures
Molecular Formula C4H8BrCl
Synonyms (2S,3R)-2-Brom-3-chlorbutan (2S,3R)-2-bromo-3-chlorobutane
Molecular Weight 171.46

What is the Iupac name of isobutylene?

IUPAC Name 2-methylprop-1-ene
Alternative Names Isobutene 2-Methylpropene 2-Methylpropylene
Molecular Formula C4H8
Molar Mass 56.108 g/mol
InChI InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3
INTERESTING:  Is there a Supra in Need for Speed Rivals?

What is the Iupac name of Chloretone?

– So, we can say that the IUPAC name of chloretone is, 1, 1, 1- trichloro-2-methyl-2-propanol.

What is the structure of 2 ethyl propane?

2-Ethylpropane-1,3-diol

PubChem CID 102293
Molecular Formula C5H12O2
Synonyms 2-Ethylpropane-1,3-diol 2612-29-5 2-ETHYL-1,3-PROPANEDIOL 1,3-Propanediol, 2-ethyl- UNII-9YQ4707ATI More…
Molecular Weight 104.15
Dates Modify 2021-12-11 Create 2005-08-08

What is the boiling point of 2 2 3 Trimethylbutane?

The octane number is determined by comparing, under standard conditions, the knock intensity of the fuel with that of blends of two reference fuels: iso-octane, which resists knocking, and heptane, which knocks readily.

What is the common name of 2 2 Dimethylpentane?

2,2-Dimethylpentane is one of the isomers of heptane. It is also called neoheptane as it contains the (CH3)3C grouping.